C28H39NO4 — CID 102048204
(E,4R,5R)-5-hydroxy-1-(octylamino)-4,6-bis(phenylmethoxy)hex-1-en-3-one (PubChem CID 102048204) has the molecular formula C28H39NO4 and a molecular weight of 453.62 g/mol. Its IUPAC name is (E,4R,5R)-5-hydroxy-1-(octylamino)-4,6-bis(phenylmethoxy)hex-1-en-3-one.
| Compound Name | (E,4R,5R)-5-hydroxy-1-(octylamino)-4,6-bis(phenylmethoxy)hex-1-en-3-one |
|---|---|
| PubChem CID | 102048204 |
| Molecular Formula | C28H39NO4 |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | (E,4R,5R)-5-hydroxy-1-(octylamino)-4,6-bis(phenylmethoxy)hex-1-en-3-one |
| SMILES | CCCCCCCCN/C=C/C(=O)[C@H](OCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C28H39NO4/c1-2-3-4-5-6-13-19-29-20-18-26(30)28(33-22-25-16-11-8-12-17-25)27(31)23-32-21-24-14-9-7-10-15-24/h7-12,14-18,20,27-29,31H,2-6,13,19,21-23H2,1H3/b20-18+/t27-,28+/m1/s1 |
| InChIKey | CCPYVSCTAPBIMN-WIEQQYTHSA-N |
| XLogP | 5.18 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|