C14H18O4 — CID 10901044
(E,4S,5R)-5-hydroxy-4-methyl-6-phenylmethoxyhex-2-enoic acid (PubChem CID 10901044) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is (E,4S,5R)-5-hydroxy-4-methyl-6-phenylmethoxyhex-2-enoic acid.
| Compound Name | (E,4S,5R)-5-hydroxy-4-methyl-6-phenylmethoxyhex-2-enoic acid |
|---|---|
| PubChem CID | 10901044 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (E,4S,5R)-5-hydroxy-4-methyl-6-phenylmethoxyhex-2-enoic acid |
| SMILES | C[C@@H](/C=C/C(=O)O)[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C14H18O4/c1-11(7-8-14(16)17)13(15)10-18-9-12-5-3-2-4-6-12/h2-8,11,13,15H,9-10H2,1H3,(H,16,17)/b8-7+/t11-,13-/m0/s1 |
| InChIKey | JFIVOELSMXIKLT-DDOQPMFUSA-N |
| XLogP | 1.84 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|