C29H39NO4 — CID 102492240
(Z,2E,5R)-5-hydroxy-2-[(octylamino)methylidene]-4,6-bis(phenylmethoxy)hex-3-enal (PubChem CID 102492240) has the molecular formula C29H39NO4 and a molecular weight of 465.63 g/mol. Its IUPAC name is (Z,2E,5R)-5-hydroxy-2-[(octylamino)methylidene]-4,6-bis(phenylmethoxy)hex-3-enal.
| Compound Name | (Z,2E,5R)-5-hydroxy-2-[(octylamino)methylidene]-4,6-bis(phenylmethoxy)hex-3-enal |
|---|---|
| PubChem CID | 102492240 |
| Molecular Formula | C29H39NO4 |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | (Z,2E,5R)-5-hydroxy-2-[(octylamino)methylidene]-4,6-bis(phenylmethoxy)hex-3-enal |
| SMILES | CCCCCCCCN/C=C(C=O)\C=C(/OCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C29H39NO4/c1-2-3-4-5-6-13-18-30-20-27(21-31)19-29(34-23-26-16-11-8-12-17-26)28(32)24-33-22-25-14-9-7-10-15-25/h7-12,14-17,19-21,28,30,32H,2-6,13,18,22-24H2,1H3/b27-20+,29-19-/t28-/m1/s1 |
| InChIKey | ZQVBHENFNGFOJP-QABQVCBYSA-N |
| XLogP | 5.70 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|