C20H24O4S — CID 100958277
S-ethyl (2R,3S)-3-hydroxy-2,4-bis(phenylmethoxy)butanethioate (PubChem CID 100958277) has the molecular formula C20H24O4S and a molecular weight of 360.47 g/mol. Its IUPAC name is S-ethyl (2R,3S)-3-hydroxy-2,4-bis(phenylmethoxy)butanethioate.
| Compound Name | S-ethyl (2R,3S)-3-hydroxy-2,4-bis(phenylmethoxy)butanethioate |
|---|---|
| PubChem CID | 100958277 |
| Molecular Formula | C20H24O4S |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | S-ethyl (2R,3S)-3-hydroxy-2,4-bis(phenylmethoxy)butanethioate |
| SMILES | CCSC(=O)[C@H](OCc1ccccc1)[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C20H24O4S/c1-2-25-20(22)19(24-14-17-11-7-4-8-12-17)18(21)15-23-13-16-9-5-3-6-10-16/h3-12,18-19,21H,2,13-15H2,1H3/t18-,19+/m0/s1 |
| InChIKey | UPOKXOGQDJGTEI-RBUKOAKNSA-N |
| XLogP | 3.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|