C17H24O4S — CID 11759150
S-ethyl (Z,2R,3R)-3-(methoxymethoxy)-2-phenylmethoxyhex-4-enethioate (PubChem CID 11759150) has the molecular formula C17H24O4S and a molecular weight of 324.44 g/mol. Its IUPAC name is S-ethyl (Z,2R,3R)-3-(methoxymethoxy)-2-phenylmethoxyhex-4-enethioate.
| Compound Name | S-ethyl (Z,2R,3R)-3-(methoxymethoxy)-2-phenylmethoxyhex-4-enethioate |
|---|---|
| PubChem CID | 11759150 |
| Molecular Formula | C17H24O4S |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | S-ethyl (Z,2R,3R)-3-(methoxymethoxy)-2-phenylmethoxyhex-4-enethioate |
| SMILES | C/C=C\[C@@H](OCOC)[C@@H](OCc1ccccc1)C(=O)SCC |
| InChI | InChI=1S/C17H24O4S/c1-4-9-15(21-13-19-3)16(17(18)22-5-2)20-12-14-10-7-6-8-11-14/h4,6-11,15-16H,5,12-13H2,1-3H3/b9-4-/t15-,16-/m1/s1 |
| InChIKey | VNBYMBQFZCXNFJ-JKUHXPQUSA-N |
| XLogP | 3.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|