C35H38O4S2 — CID 135062523
(5S,6R)-6-hydroxy-1,1-bis[(4-methylphenyl)sulfanyl]-5,7-bis(phenylmethoxy)heptan-4-one (PubChem CID 135062523) has the molecular formula C35H38O4S2 and a molecular weight of 586.82 g/mol. Its IUPAC name is (5S,6R)-6-hydroxy-1,1-bis[(4-methylphenyl)sulfanyl]-5,7-bis(phenylmethoxy)heptan-4-one.
| Compound Name | (5S,6R)-6-hydroxy-1,1-bis[(4-methylphenyl)sulfanyl]-5,7-bis(phenylmethoxy)heptan-4-one |
|---|---|
| PubChem CID | 135062523 |
| Molecular Formula | C35H38O4S2 |
| Molecular Weight | 586.82 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | (5S,6R)-6-hydroxy-1,1-bis[(4-methylphenyl)sulfanyl]-5,7-bis(phenylmethoxy)heptan-4-one |
| SMILES | Cc1ccc(SC(CCC(=O)[C@@H](OCc2ccccc2)[C@H](O)COCc2ccccc2)Sc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C35H38O4S2/c1-26-13-17-30(18-14-26)40-34(41-31-19-15-27(2)16-20-31)22-21-32(36)35(39-24-29-11-7-4-8-12-29)33(37)25-38-23-28-9-5-3-6-10-28/h3-20,33-35,37H,21-25H2,1-2H3/t33-,35-/m1/s1 |
| InChIKey | IMHDLKXNTMOZCX-VLZNPVHKSA-N |
| XLogP | 8.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.82 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|