C24H31NO4 — CID 102048207
(E,4R,5R)-1-(diethylamino)-5-hydroxy-4,6-bis(phenylmethoxy)hex-1-en-3-one (PubChem CID 102048207) has the molecular formula C24H31NO4 and a molecular weight of 397.51 g/mol. Its IUPAC name is (E,4R,5R)-1-(diethylamino)-5-hydroxy-4,6-bis(phenylmethoxy)hex-1-en-3-one.
| Compound Name | (E,4R,5R)-1-(diethylamino)-5-hydroxy-4,6-bis(phenylmethoxy)hex-1-en-3-one |
|---|---|
| PubChem CID | 102048207 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | (E,4R,5R)-1-(diethylamino)-5-hydroxy-4,6-bis(phenylmethoxy)hex-1-en-3-one |
| SMILES | CCN(/C=C/C(=O)[C@H](OCc1ccccc1)[C@H](O)COCc1ccccc1)CC |
| InChI | InChI=1S/C24H31NO4/c1-3-25(4-2)16-15-22(26)24(29-18-21-13-9-6-10-14-21)23(27)19-28-17-20-11-7-5-8-12-20/h5-16,23-24,27H,3-4,17-19H2,1-2H3/b16-15+/t23-,24+/m1/s1 |
| InChIKey | QRCVLGGPQWECJD-DYQZOYDYSA-N |
| XLogP | 3.57 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|