C18H28O5 — CID 87328584
(3R,4S,5R)-3,5-dihydroxy-6-pentoxy-4-phenylmethoxyhexanal (PubChem CID 87328584) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is (3R,4S,5R)-3,5-dihydroxy-6-pentoxy-4-phenylmethoxyhexanal.
| Compound Name | (3R,4S,5R)-3,5-dihydroxy-6-pentoxy-4-phenylmethoxyhexanal |
|---|---|
| PubChem CID | 87328584 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (3R,4S,5R)-3,5-dihydroxy-6-pentoxy-4-phenylmethoxyhexanal |
| SMILES | CCCCCOC[C@@H](O)[C@@H](OCc1ccccc1)[C@H](O)CC=O |
| InChI | InChI=1S/C18H28O5/c1-2-3-7-12-22-14-17(21)18(16(20)10-11-19)23-13-15-8-5-4-6-9-15/h4-6,8-9,11,16-18,20-21H,2-3,7,10,12-14H2,1H3/t16-,17-,18+/m1/s1 |
| InChIKey | FRHLGQMGPFVDQE-KURKYZTESA-N |
| XLogP | 2.09 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|