C30H35NO8 — CID 132559185
methyl (4R,5R,6S,7R)-7-hydroxy-4-nitro-5,6,8-tris(phenylmethoxy)octanoate (PubChem CID 132559185) has the molecular formula C30H35NO8 and a molecular weight of 537.61 g/mol. Its IUPAC name is methyl (4R,5R,6S,7R)-7-hydroxy-4-nitro-5,6,8-tris(phenylmethoxy)octanoate.
| Compound Name | methyl (4R,5R,6S,7R)-7-hydroxy-4-nitro-5,6,8-tris(phenylmethoxy)octanoate |
|---|---|
| PubChem CID | 132559185 |
| Molecular Formula | C30H35NO8 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | methyl (4R,5R,6S,7R)-7-hydroxy-4-nitro-5,6,8-tris(phenylmethoxy)octanoate |
| SMILES | COC(=O)CC[C@H]([C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](O)COCc1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C30H35NO8/c1-36-28(33)18-17-26(31(34)35)29(38-20-24-13-7-3-8-14-24)30(39-21-25-15-9-4-10-16-25)27(32)22-37-19-23-11-5-2-6-12-23/h2-16,26-27,29-30,32H,17-22H2,1H3/t26-,27-,29-,30+/m1/s1 |
| InChIKey | SJSKKSGHRXCGGR-OQGMSKNBSA-N |
| XLogP | 4.33 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|