C33H36N2O8S — CID 25207924
N-[(3R,4S,5R)-5-hydroxy-3,4,6-tris(phenylmethoxy)hexyl]-4-nitrobenzenesulfonamide (PubChem CID 25207924) has the molecular formula C33H36N2O8S and a molecular weight of 620.72 g/mol. Its IUPAC name is N-[(3R,4S,5R)-5-hydroxy-3,4,6-tris(phenylmethoxy)hexyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[(3R,4S,5R)-5-hydroxy-3,4,6-tris(phenylmethoxy)hexyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 25207924 |
| Molecular Formula | C33H36N2O8S |
| Molecular Weight | 620.72 g/mol |
| Exact Mass | 620.22 |
| IUPAC Name | N-[(3R,4S,5R)-5-hydroxy-3,4,6-tris(phenylmethoxy)hexyl]-4-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)NCC[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](O)COCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H36N2O8S/c36-31(25-41-22-26-10-4-1-5-11-26)33(43-24-28-14-8-3-9-15-28)32(42-23-27-12-6-2-7-13-27)20-21-34-44(39,40)30-18-16-29(17-19-30)35(37)38/h1-19,31-34,36H,20-25H2/t31-,32-,33+/m1/s1 |
| InChIKey | UYTNTNFFWAGFNC-SLGZMBILSA-N |
| XLogP | 5.01 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.72 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|