C27H28FNO8 — CID 101470836
[(2R,3S,4S,5R)-5-fluoro-3,4-dihydroxy-2,6-bis(phenylmethoxy)hexyl] 4-nitrobenzoate (PubChem CID 101470836) has the molecular formula C27H28FNO8 and a molecular weight of 513.52 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-fluoro-3,4-dihydroxy-2,6-bis(phenylmethoxy)hexyl] 4-nitrobenzoate.
| Compound Name | [(2R,3S,4S,5R)-5-fluoro-3,4-dihydroxy-2,6-bis(phenylmethoxy)hexyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 101470836 |
| Molecular Formula | C27H28FNO8 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | [(2R,3S,4S,5R)-5-fluoro-3,4-dihydroxy-2,6-bis(phenylmethoxy)hexyl] 4-nitrobenzoate |
| SMILES | O=C(OC[C@@H](OCc1ccccc1)[C@@H](O)[C@H](O)[C@H](F)COCc1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H28FNO8/c28-23(17-35-15-19-7-3-1-4-8-19)25(30)26(31)24(36-16-20-9-5-2-6-10-20)18-37-27(32)21-11-13-22(14-12-21)29(33)34/h1-14,23-26,30-31H,15-18H2/t23-,24-,25-,26-/m1/s1 |
| InChIKey | OZIJMFSRNILYAN-VEYUFSJPSA-N |
| XLogP | 3.61 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|