C17H17NO5 — CID 102383826
(3S,4S)-4-hydroxy-4-(4-nitrophenyl)-3-phenylmethoxybutan-2-one (PubChem CID 102383826) has the molecular formula C17H17NO5 and a molecular weight of 315.32 g/mol. Its IUPAC name is (3S,4S)-4-hydroxy-4-(4-nitrophenyl)-3-phenylmethoxybutan-2-one.
| Compound Name | (3S,4S)-4-hydroxy-4-(4-nitrophenyl)-3-phenylmethoxybutan-2-one |
|---|---|
| PubChem CID | 102383826 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | (3S,4S)-4-hydroxy-4-(4-nitrophenyl)-3-phenylmethoxybutan-2-one |
| SMILES | CC(=O)[C@@H](OCc1ccccc1)[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H17NO5/c1-12(19)17(23-11-13-5-3-2-4-6-13)16(20)14-7-9-15(10-8-14)18(21)22/h2-10,16-17,20H,11H2,1H3/t16-,17+/m0/s1 |
| InChIKey | DLODAVVEYSWWNX-DLBZAZTESA-N |
| XLogP | 2.80 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|