C18H19NO3S — CID 139116738
(3R,4R)-4-benzylsulfanyl-3-methyl-4-(4-nitrophenyl)butan-2-one (PubChem CID 139116738) has the molecular formula C18H19NO3S and a molecular weight of 329.42 g/mol. Its IUPAC name is (3R,4R)-4-benzylsulfanyl-3-methyl-4-(4-nitrophenyl)butan-2-one.
| Compound Name | (3R,4R)-4-benzylsulfanyl-3-methyl-4-(4-nitrophenyl)butan-2-one |
|---|---|
| PubChem CID | 139116738 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | (3R,4R)-4-benzylsulfanyl-3-methyl-4-(4-nitrophenyl)butan-2-one |
| SMILES | CC(=O)[C@@H](C)[C@@H](SCc1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H19NO3S/c1-13(14(2)20)18(23-12-15-6-4-3-5-7-15)16-8-10-17(11-9-16)19(21)22/h3-11,13,18H,12H2,1-2H3/t13-,18-/m1/s1 |
| InChIKey | BFWCSTQJYCTSNR-FZKQIMNGSA-N |
| XLogP | 4.79 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|