C18H19N3O3 — CID 94796302
(2R,3S)-2-[[benzyl(methyl)amino]methyl]-3-hydroxy-3-(4-nitrophenyl)propanenitrile (PubChem CID 94796302) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is (2R,3S)-2-[[benzyl(methyl)amino]methyl]-3-hydroxy-3-(4-nitrophenyl)propanenitrile.
| Compound Name | (2R,3S)-2-[[benzyl(methyl)amino]methyl]-3-hydroxy-3-(4-nitrophenyl)propanenitrile |
|---|---|
| PubChem CID | 94796302 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | (2R,3S)-2-[[benzyl(methyl)amino]methyl]-3-hydroxy-3-(4-nitrophenyl)propanenitrile |
| SMILES | CN(Cc1ccccc1)C[C@H](C#N)[C@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H19N3O3/c1-20(12-14-5-3-2-4-6-14)13-16(11-19)18(22)15-7-9-17(10-8-15)21(23)24/h2-10,16,18,22H,12-13H2,1H3/t16-,18+/m0/s1 |
| InChIKey | KJGIXGGJUXKFTJ-FUHWJXTLSA-N |
| XLogP | 2.90 |
| TPSA | 90.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|