C36H34N2O4 — CID 102357270
(1S,2S)-2-[benzyl(methyl)amino]-1-(4-nitrophenyl)-3-trityloxypropan-1-ol (PubChem CID 102357270) has the molecular formula C36H34N2O4 and a molecular weight of 558.68 g/mol. Its IUPAC name is (1S,2S)-2-[benzyl(methyl)amino]-1-(4-nitrophenyl)-3-trityloxypropan-1-ol.
| Compound Name | (1S,2S)-2-[benzyl(methyl)amino]-1-(4-nitrophenyl)-3-trityloxypropan-1-ol |
|---|---|
| PubChem CID | 102357270 |
| Molecular Formula | C36H34N2O4 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | (1S,2S)-2-[benzyl(methyl)amino]-1-(4-nitrophenyl)-3-trityloxypropan-1-ol |
| SMILES | CN(Cc1ccccc1)[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C36H34N2O4/c1-37(26-28-14-6-2-7-15-28)34(35(39)29-22-24-33(25-23-29)38(40)41)27-42-36(30-16-8-3-9-17-30,31-18-10-4-11-19-31)32-20-12-5-13-21-32/h2-25,34-35,39H,26-27H2,1H3/t34-,35-/m0/s1 |
| InChIKey | PJNWXYWBCYQPAI-PXLJZGITSA-N |
| XLogP | 7.14 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|