C30H32N4O3 — CID 164900865
(1R,2R)-2-N',2-N'-dimethyl-1-(4-nitrophenyl)-3-trityloxypropane-1,2,2-triamine (PubChem CID 164900865) has the molecular formula C30H32N4O3 and a molecular weight of 496.61 g/mol. Its IUPAC name is (1R,2R)-2-N',2-N'-dimethyl-1-(4-nitrophenyl)-3-trityloxypropane-1,2,2-triamine.
| Compound Name | (1R,2R)-2-N',2-N'-dimethyl-1-(4-nitrophenyl)-3-trityloxypropane-1,2,2-triamine |
|---|---|
| PubChem CID | 164900865 |
| Molecular Formula | C30H32N4O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | (1R,2R)-2-N',2-N'-dimethyl-1-(4-nitrophenyl)-3-trityloxypropane-1,2,2-triamine |
| SMILES | CN(C)[C@@](N)(COC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@H](N)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H32N4O3/c1-33(2)29(32,28(31)23-18-20-27(21-19-23)34(35)36)22-37-30(24-12-6-3-7-13-24,25-14-8-4-9-15-25)26-16-10-5-11-17-26/h3-21,28H,22,31-32H2,1-2H3/t28-,29+/m1/s1 |
| InChIKey | QQPIUXQXXAGQQL-WDYNHAJCSA-N |
| XLogP | 4.82 |
| TPSA | 107.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|