C26H23N3O2 — CID 160842262
1-methyl-1-[(4-nitrophenyl)-phenylmethyl]-2,2-diphenylhydrazine (PubChem CID 160842262) has the molecular formula C26H23N3O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 1-methyl-1-[(4-nitrophenyl)-phenylmethyl]-2,2-diphenylhydrazine.
| Compound Name | 1-methyl-1-[(4-nitrophenyl)-phenylmethyl]-2,2-diphenylhydrazine |
|---|---|
| PubChem CID | 160842262 |
| Molecular Formula | C26H23N3O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 1-methyl-1-[(4-nitrophenyl)-phenylmethyl]-2,2-diphenylhydrazine |
| SMILES | CN(C(c1ccccc1)c1ccc([N+](=O)[O-])cc1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H23N3O2/c1-27(28(23-13-7-3-8-14-23)24-15-9-4-10-16-24)26(21-11-5-2-6-12-21)22-17-19-25(20-18-22)29(30)31/h2-20,26H,1H3 |
| InChIKey | SIEKWLYIKLTKDF-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|