C16H19N3O4 — CID 96998510
1-[(2R)-3-[benzyl(methyl)amino]-2-hydroxypropyl]-5-nitropyridin-2-one (PubChem CID 96998510) has the molecular formula C16H19N3O4 and a molecular weight of 317.34 g/mol. Its IUPAC name is 1-[(2R)-3-[benzyl(methyl)amino]-2-hydroxypropyl]-5-nitropyridin-2-one.
| Compound Name | 1-[(2R)-3-[benzyl(methyl)amino]-2-hydroxypropyl]-5-nitropyridin-2-one |
|---|---|
| PubChem CID | 96998510 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 1-[(2R)-3-[benzyl(methyl)amino]-2-hydroxypropyl]-5-nitropyridin-2-one |
| SMILES | CN(Cc1ccccc1)C[C@@H](O)Cn1cc([N+](=O)[O-])ccc1=O |
| InChI | InChI=1S/C16H19N3O4/c1-17(9-13-5-3-2-4-6-13)11-15(20)12-18-10-14(19(22)23)7-8-16(18)21/h2-8,10,15,20H,9,11-12H2,1H3/t15-/m1/s1 |
| InChIKey | QYUHXBARVAKERK-OAHLLOKOSA-N |
| XLogP | 1.25 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|