C21H30N4O3S — CID 86882570
4-[4-[3-[benzyl(methyl)amino]-2-hydroxypropyl]piperazin-1-yl]benzenesulfonamide (PubChem CID 86882570) has the molecular formula C21H30N4O3S and a molecular weight of 418.56 g/mol. Its IUPAC name is 4-[4-[3-[benzyl(methyl)amino]-2-hydroxypropyl]piperazin-1-yl]benzenesulfonamide.
| Compound Name | 4-[4-[3-[benzyl(methyl)amino]-2-hydroxypropyl]piperazin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 86882570 |
| Molecular Formula | C21H30N4O3S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 4-[4-[3-[benzyl(methyl)amino]-2-hydroxypropyl]piperazin-1-yl]benzenesulfonamide |
| SMILES | CN(Cc1ccccc1)CC(O)CN1CCN(c2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C21H30N4O3S/c1-23(15-18-5-3-2-4-6-18)16-20(26)17-24-11-13-25(14-12-24)19-7-9-21(10-8-19)29(22,27)28/h2-10,20,26H,11-17H2,1H3,(H2,22,27,28) |
| InChIKey | NVEULCQLVMLDCK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |