C22H30N4O4S — CID 12724068
N-[4-[[2-hydroxy-3-(4-phenylpiperazin-1-yl)propyl]-methylsulfonylamino]phenyl]acetamide (PubChem CID 12724068) has the molecular formula C22H30N4O4S and a molecular weight of 446.57 g/mol. Its IUPAC name is N-[4-[[2-hydroxy-3-(4-phenylpiperazin-1-yl)propyl]-methylsulfonylamino]phenyl]acetamide.
| Compound Name | N-[4-[[2-hydroxy-3-(4-phenylpiperazin-1-yl)propyl]-methylsulfonylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 12724068 |
| Molecular Formula | C22H30N4O4S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | N-[4-[[2-hydroxy-3-(4-phenylpiperazin-1-yl)propyl]-methylsulfonylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N(CC(O)CN2CCN(c3ccccc3)CC2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H30N4O4S/c1-18(27)23-19-8-10-21(11-9-19)26(31(2,29)30)17-22(28)16-24-12-14-25(15-13-24)20-6-4-3-5-7-20/h3-11,22,28H,12-17H2,1-2H3,(H,23,27) |
| InChIKey | GWHQQCHPWUZYIY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |