C21H27Cl2N3O4S — CID 12724020
N-(3,4-dichlorophenyl)-N-[2-hydroxy-3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]methanesulfonamide (PubChem CID 12724020) has the molecular formula C21H27Cl2N3O4S and a molecular weight of 488.44 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-N-[2-hydroxy-3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]methanesulfonamide.
| Compound Name | N-(3,4-dichlorophenyl)-N-[2-hydroxy-3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 12724020 |
| Molecular Formula | C21H27Cl2N3O4S |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | N-(3,4-dichlorophenyl)-N-[2-hydroxy-3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]methanesulfonamide |
| SMILES | COc1ccc(N2CCN(CC(O)CN(c3ccc(Cl)c(Cl)c3)S(C)(=O)=O)CC2)cc1 |
| InChI | InChI=1S/C21H27Cl2N3O4S/c1-30-19-6-3-16(4-7-19)25-11-9-24(10-12-25)14-18(27)15-26(31(2,28)29)17-5-8-20(22)21(23)13-17/h3-8,13,18,27H,9-12,14-15H2,1-2H3 |
| InChIKey | ASYINVRPOTWQTP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|