C22H33N5O3 — CID 75449607
1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-[4-(1,2-oxazol-3-ylmethyl)piperazin-1-yl]propan-2-ol (PubChem CID 75449607) has the molecular formula C22H33N5O3 and a molecular weight of 415.54 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-[4-(1,2-oxazol-3-ylmethyl)piperazin-1-yl]propan-2-ol.
| Compound Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-[4-(1,2-oxazol-3-ylmethyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 75449607 |
| Molecular Formula | C22H33N5O3 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-[4-(1,2-oxazol-3-ylmethyl)piperazin-1-yl]propan-2-ol |
| SMILES | COc1ccc(N2CCN(CC(O)CN3CCN(Cc4ccon4)CC3)CC2)cc1 |
| InChI | InChI=1S/C22H33N5O3/c1-29-22-4-2-20(3-5-22)27-13-11-26(12-14-27)18-21(28)17-25-9-7-24(8-10-25)16-19-6-15-30-23-19/h2-6,15,21,28H,7-14,16-18H2,1H3 |
| InChIKey | MXXACFSAAGLVEJ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|