C17H23N3O2 — CID 75375213
1-(4-methoxyphenyl)-N-methyl-N-(1,2-oxazol-3-ylmethyl)piperidin-4-amine (PubChem CID 75375213) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-methyl-N-(1,2-oxazol-3-ylmethyl)piperidin-4-amine.
| Compound Name | 1-(4-methoxyphenyl)-N-methyl-N-(1,2-oxazol-3-ylmethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 75375213 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-methyl-N-(1,2-oxazol-3-ylmethyl)piperidin-4-amine |
| SMILES | COc1ccc(N2CCC(N(C)Cc3ccon3)CC2)cc1 |
| InChI | InChI=1S/C17H23N3O2/c1-19(13-14-9-12-22-18-14)15-7-10-20(11-8-15)16-3-5-17(21-2)6-4-16/h3-6,9,12,15H,7-8,10-11,13H2,1-2H3 |
| InChIKey | BYRXLLVUEMORIT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|