About 3-[[(3R)-3-(3,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-1,2-oxazole
3-[[(3R)-3-(3,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-1,2-oxazole (PubChem CID 96925768) has the molecular formula C16H20N2O3
and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-[[(3R)-3-(3,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-1,2-oxazole.
Molecular Properties
| Compound Name | 3-[[(3R)-3-(3,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-1,2-oxazole |
| PubChem CID | 96925768 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 3-[[(3R)-3-(3,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-1,2-oxazole |
| SMILES | COc1cc(OC)cc([C@H]2CCN(Cc3ccon3)C2)c1 |
| InChI | InChI=1S/C16H20N2O3/c1-19-15-7-13(8-16(9-15)20-2)12-3-5-18(10-12)11-14-4-6-21-17-14/h4,6-9,12H,3,5,10-11H2,1-2H3/t12-/m0/s1 |
| InChIKey | ZNHJZHXEWZYSKO-LBPRGKRZSA-N |
| XLogP | 2.68 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[(3R)-3-(3,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(3R)-3-(3,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-1,2-oxazole?
The IUPAC name of 3-[[(3R)-3-(3,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-1,2-oxazole (CID 96925768) is 3-[[(3R)-3-(3,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-1,2-oxazole.
What is the SMILES notation for 3-[[(3R)-3-(3,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-1,2-oxazole?
The canonical SMILES for 3-[[(3R)-3-(3,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-1,2-oxazole is COc1cc(OC)cc([C@H]2CCN(Cc3ccon3)C2)c1.
What is the InChIKey of 3-[[(3R)-3-(3,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-1,2-oxazole?
The InChIKey is ZNHJZHXEWZYSKO-LBPRGKRZSA-N. The full InChI is InChI=1S/C16H20N2O3/c1-19-15-7-13(8-16(9-15)20-2)12-3-5-18(10-12)11-14-4-6-21-17-14/h4,6-9,12H,3,5,10-11H2,1-2H3/t12-/m0/s1.
What are the key properties of 3-[[(3R)-3-(3,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-1,2-oxazole?
3-[[(3R)-3-(3,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-1,2-oxazole has a molecular weight of 288.35 g/mol, XLogP of 2.68, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3R)-3-(3,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-1,2-oxazole is sourced from PubChem (CID 96925768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).