About 3-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,2-oxazole
3-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,2-oxazole (PubChem CID 166211745) has the molecular formula C12H15N3OS
and a molecular weight of 249.34 g/mol. Its IUPAC name is 3-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,2-oxazole.
Molecular Properties
| Compound Name | 3-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,2-oxazole |
| PubChem CID | 166211745 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 3-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,2-oxazole |
| SMILES | c1csc(C2CCCN(Cc3ccon3)C2)n1 |
| InChI | InChI=1S/C12H15N3OS/c1-2-10(12-13-4-7-17-12)8-15(5-1)9-11-3-6-16-14-11/h3-4,6-7,10H,1-2,5,8-9H2 |
| InChIKey | VSYARJUGKHSSPO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,2-oxazole?
The IUPAC name of 3-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,2-oxazole (CID 166211745) is 3-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,2-oxazole.
What is the SMILES notation for 3-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,2-oxazole?
The canonical SMILES for 3-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,2-oxazole is c1csc(C2CCCN(Cc3ccon3)C2)n1.
What is the InChIKey of 3-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,2-oxazole?
The InChIKey is VSYARJUGKHSSPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3OS/c1-2-10(12-13-4-7-17-12)8-15(5-1)9-11-3-6-16-14-11/h3-4,6-7,10H,1-2,5,8-9H2.
What are the key properties of 3-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,2-oxazole?
3-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,2-oxazole has a molecular weight of 249.34 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,2-oxazole is sourced from PubChem (CID 166211745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).