About [4-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]phenyl]methanol
[4-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]phenyl]methanol (PubChem CID 110008771) has the molecular formula C16H20N2OS
and a molecular weight of 288.42 g/mol. Its IUPAC name is [4-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]phenyl]methanol.
Molecular Properties
| Compound Name | [4-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]phenyl]methanol |
| PubChem CID | 110008771 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | [4-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]phenyl]methanol |
| SMILES | OCc1ccc(CN2CCCC(c3nccs3)C2)cc1 |
| InChI | InChI=1S/C16H20N2OS/c19-12-14-5-3-13(4-6-14)10-18-8-1-2-15(11-18)16-17-7-9-20-16/h3-7,9,15,19H,1-2,8,10-12H2 |
| InChIKey | YHOYMEMAUJJGJQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]phenyl]methanol?
The IUPAC name of [4-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]phenyl]methanol (CID 110008771) is [4-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]phenyl]methanol.
What is the SMILES notation for [4-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]phenyl]methanol?
The canonical SMILES for [4-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]phenyl]methanol is OCc1ccc(CN2CCCC(c3nccs3)C2)cc1.
What is the InChIKey of [4-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]phenyl]methanol?
The InChIKey is YHOYMEMAUJJGJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2OS/c19-12-14-5-3-13(4-6-14)10-18-8-1-2-15(11-18)16-17-7-9-20-16/h3-7,9,15,19H,1-2,8,10-12H2.
What are the key properties of [4-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]phenyl]methanol?
[4-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]phenyl]methanol has a molecular weight of 288.42 g/mol, XLogP of 3.02, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[3-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]phenyl]methanol is sourced from PubChem (CID 110008771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).