C12H20N2OS — CID 110932618
2-methyl-1-[3-(1,3-thiazol-2-yl)piperidin-1-yl]propan-2-ol (PubChem CID 110932618) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is 2-methyl-1-[3-(1,3-thiazol-2-yl)piperidin-1-yl]propan-2-ol.
| Compound Name | 2-methyl-1-[3-(1,3-thiazol-2-yl)piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 110932618 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 2-methyl-1-[3-(1,3-thiazol-2-yl)piperidin-1-yl]propan-2-ol |
| SMILES | CC(C)(O)CN1CCCC(c2nccs2)C1 |
| InChI | InChI=1S/C12H20N2OS/c1-12(2,15)9-14-6-3-4-10(8-14)11-13-5-7-16-11/h5,7,10,15H,3-4,6,8-9H2,1-2H3 |
| InChIKey | HXUBDVASJDJZEV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |