C17H19N3S — CID 155986420
2-[1-(1H-indol-4-ylmethyl)piperidin-3-yl]-1,3-thiazole (PubChem CID 155986420) has the molecular formula C17H19N3S and a molecular weight of 297.43 g/mol. Its IUPAC name is 2-[1-(1H-indol-4-ylmethyl)piperidin-3-yl]-1,3-thiazole.
| Compound Name | 2-[1-(1H-indol-4-ylmethyl)piperidin-3-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 155986420 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-[1-(1H-indol-4-ylmethyl)piperidin-3-yl]-1,3-thiazole |
| SMILES | c1cc(CN2CCCC(c3nccs3)C2)c2cc[nH]c2c1 |
| InChI | InChI=1S/C17H19N3S/c1-3-13(15-6-7-18-16(15)5-1)11-20-9-2-4-14(12-20)17-19-8-10-21-17/h1,3,5-8,10,14,18H,2,4,9,11-12H2 |
| InChIKey | USBADJBVSBWHOV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |