C17H20N4 — CID 124940343
4-[[(3S)-3-(5-methyl-1H-imidazol-2-yl)pyrrolidin-1-yl]methyl]-1H-indole (PubChem CID 124940343) has the molecular formula C17H20N4 and a molecular weight of 280.38 g/mol. Its IUPAC name is 4-[[(3S)-3-(5-methyl-1H-imidazol-2-yl)pyrrolidin-1-yl]methyl]-1H-indole.
| Compound Name | 4-[[(3S)-3-(5-methyl-1H-imidazol-2-yl)pyrrolidin-1-yl]methyl]-1H-indole |
|---|---|
| PubChem CID | 124940343 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 4-[[(3S)-3-(5-methyl-1H-imidazol-2-yl)pyrrolidin-1-yl]methyl]-1H-indole |
| SMILES | Cc1cnc([C@H]2CCN(Cc3cccc4[nH]ccc34)C2)[nH]1 |
| InChI | InChI=1S/C17H20N4/c1-12-9-19-17(20-12)14-6-8-21(11-14)10-13-3-2-4-16-15(13)5-7-18-16/h2-5,7,9,14,18H,6,8,10-11H2,1H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | AFNZXEDPAGBDKG-AWEZNQCLSA-N |
| XLogP | 3.19 |
| TPSA | 47.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |