C19H32N4O3 — CID 97261065
2-[[(2S)-2-hydroxy-3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-methylamino]-N,N-dimethylacetamide (PubChem CID 97261065) has the molecular formula C19H32N4O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-[[(2S)-2-hydroxy-3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-methylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(2S)-2-hydroxy-3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-methylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 97261065 |
| Molecular Formula | C19H32N4O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 2-[[(2S)-2-hydroxy-3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-methylamino]-N,N-dimethylacetamide |
| SMILES | COc1ccc(N2CCN(C[C@@H](O)CN(C)CC(=O)N(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H32N4O3/c1-20(2)19(25)15-21(3)13-17(24)14-22-9-11-23(12-10-22)16-5-7-18(26-4)8-6-16/h5-8,17,24H,9-15H2,1-4H3/t17-/m0/s1 |
| InChIKey | YBVZYRZJCGMCEK-KRWDZBQOSA-N |
| XLogP | 0.20 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|