C25H36N4O2 — CID 166191408
2-(dibenzylamino)-N-[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]-N-methylacetamide (PubChem CID 166191408) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 2-(dibenzylamino)-N-[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]-N-methylacetamide.
| Compound Name | 2-(dibenzylamino)-N-[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]-N-methylacetamide |
|---|---|
| PubChem CID | 166191408 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 2-(dibenzylamino)-N-[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]-N-methylacetamide |
| SMILES | CN1CCN(CC(O)CN(C)C(=O)CN(Cc2ccccc2)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H36N4O2/c1-26-13-15-28(16-14-26)20-24(30)19-27(2)25(31)21-29(17-22-9-5-3-6-10-22)18-23-11-7-4-8-12-23/h3-12,24,30H,13-21H2,1-2H3 |
| InChIKey | GQZVBRWDURNDTP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |