C16H27N3O3 — CID 111695342
3-(furan-2-yl)-N-[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]-N-methylpropanamide (PubChem CID 111695342) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]-N-methylpropanamide.
| Compound Name | 3-(furan-2-yl)-N-[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 111695342 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 3-(furan-2-yl)-N-[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]-N-methylpropanamide |
| SMILES | CN1CCN(CC(O)CN(C)C(=O)CCc2ccco2)CC1 |
| InChI | InChI=1S/C16H27N3O3/c1-17-7-9-19(10-8-17)13-14(20)12-18(2)16(21)6-5-15-4-3-11-22-15/h3-4,11,14,20H,5-10,12-13H2,1-2H3 |
| InChIKey | MMKFLPBHGDDOPZ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |