C16H20N2O4 — CID 174445596
benzene-1,2-diol;N-methyl-N-[(4-nitrophenyl)methyl]ethanamine (PubChem CID 174445596) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is benzene-1,2-diol;N-methyl-N-[(4-nitrophenyl)methyl]ethanamine.
| Compound Name | benzene-1,2-diol;N-methyl-N-[(4-nitrophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 174445596 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | benzene-1,2-diol;N-methyl-N-[(4-nitrophenyl)methyl]ethanamine |
| SMILES | CCN(C)Cc1ccc([N+](=O)[O-])cc1.Oc1ccccc1O |
| InChI | InChI=1S/C10H14N2O2.C6H6O2/c1-3-11(2)8-9-4-6-10(7-5-9)12(13)14;7-5-3-1-2-4-6(5)8/h4-7H,3,8H2,1-2H3;1-4,7-8H |
| InChIKey | IENKTEROOIVOLJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|