C44H47NO5 — CID 11250911
(3S,4R,5S,6R)-6-(benzylamino)-1,3,4,5-tetrakis(phenylmethoxy)non-8-en-2-one (PubChem CID 11250911) has the molecular formula C44H47NO5 and a molecular weight of 669.86 g/mol. Its IUPAC name is (3S,4R,5S,6R)-6-(benzylamino)-1,3,4,5-tetrakis(phenylmethoxy)non-8-en-2-one.
| Compound Name | (3S,4R,5S,6R)-6-(benzylamino)-1,3,4,5-tetrakis(phenylmethoxy)non-8-en-2-one |
|---|---|
| PubChem CID | 11250911 |
| Molecular Formula | C44H47NO5 |
| Molecular Weight | 669.86 g/mol |
| Exact Mass | 669.35 |
| IUPAC Name | (3S,4R,5S,6R)-6-(benzylamino)-1,3,4,5-tetrakis(phenylmethoxy)non-8-en-2-one |
| SMILES | C=CC[C@@H](NCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)C(=O)COCc1ccccc1 |
| InChI | InChI=1S/C44H47NO5/c1-2-18-40(45-29-35-19-8-3-9-20-35)42(48-31-37-23-12-5-13-24-37)44(50-33-39-27-16-7-17-28-39)43(49-32-38-25-14-6-15-26-38)41(46)34-47-30-36-21-10-4-11-22-36/h2-17,19-28,40,42-45H,1,18,29-34H2/t40-,42+,43-,44-/m1/s1 |
| InChIKey | RPDJJPYGNFJJML-XWRSFLHJSA-N |
| XLogP | 8.26 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.86 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|