C39H45NO7 — CID 11354188
benzyl (3R,4S,5R,6R,7R)-7,8-dihydroxy-4,5,6-tris(phenylmethoxy)-3-(prop-2-enylamino)octanoate (PubChem CID 11354188) has the molecular formula C39H45NO7 and a molecular weight of 639.79 g/mol. Its IUPAC name is benzyl (3R,4S,5R,6R,7R)-7,8-dihydroxy-4,5,6-tris(phenylmethoxy)-3-(prop-2-enylamino)octanoate.
| Compound Name | benzyl (3R,4S,5R,6R,7R)-7,8-dihydroxy-4,5,6-tris(phenylmethoxy)-3-(prop-2-enylamino)octanoate |
|---|---|
| PubChem CID | 11354188 |
| Molecular Formula | C39H45NO7 |
| Molecular Weight | 639.79 g/mol |
| Exact Mass | 639.32 |
| IUPAC Name | benzyl (3R,4S,5R,6R,7R)-7,8-dihydroxy-4,5,6-tris(phenylmethoxy)-3-(prop-2-enylamino)octanoate |
| SMILES | C=CCN[C@H](CC(=O)OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)CO |
| InChI | InChI=1S/C39H45NO7/c1-2-23-40-34(24-36(43)44-26-30-15-7-3-8-16-30)37(45-27-31-17-9-4-10-18-31)39(47-29-33-21-13-6-14-22-33)38(35(42)25-41)46-28-32-19-11-5-12-20-32/h2-22,34-35,37-42H,1,23-29H2/t34-,35-,37+,38-,39-/m1/s1 |
| InChIKey | DCDVQWZDMAJUCS-UVBAHNABSA-N |
| XLogP | 5.37 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.79 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|