C20H24O5 — CID 87262078
(3R,4R,5R)-5,6-dihydroxy-3,4-bis(phenylmethoxy)hexanal (PubChem CID 87262078) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (3R,4R,5R)-5,6-dihydroxy-3,4-bis(phenylmethoxy)hexanal.
| Compound Name | (3R,4R,5R)-5,6-dihydroxy-3,4-bis(phenylmethoxy)hexanal |
|---|---|
| PubChem CID | 87262078 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (3R,4R,5R)-5,6-dihydroxy-3,4-bis(phenylmethoxy)hexanal |
| SMILES | O=CC[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)CO |
| InChI | InChI=1S/C20H24O5/c21-12-11-19(24-14-16-7-3-1-4-8-16)20(18(23)13-22)25-15-17-9-5-2-6-10-17/h1-10,12,18-20,22-23H,11,13-15H2/t18-,19-,20-/m1/s1 |
| InChIKey | WCXVYRSRVHTPHO-VAMGGRTRSA-N |
| XLogP | 2.10 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|