C35H36O6 — CID 102478567
(3S,4R,5S)-5-[(2S)-oxiran-2-yl]-1,3,4,5-tetrakis(phenylmethoxy)pentan-2-one (PubChem CID 102478567) has the molecular formula C35H36O6 and a molecular weight of 552.67 g/mol. Its IUPAC name is (3S,4R,5S)-5-[(2S)-oxiran-2-yl]-1,3,4,5-tetrakis(phenylmethoxy)pentan-2-one.
| Compound Name | (3S,4R,5S)-5-[(2S)-oxiran-2-yl]-1,3,4,5-tetrakis(phenylmethoxy)pentan-2-one |
|---|---|
| PubChem CID | 102478567 |
| Molecular Formula | C35H36O6 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | (3S,4R,5S)-5-[(2S)-oxiran-2-yl]-1,3,4,5-tetrakis(phenylmethoxy)pentan-2-one |
| SMILES | O=C(COCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H]1CO1 |
| InChI | InChI=1S/C35H36O6/c36-31(25-37-21-27-13-5-1-6-14-27)33(39-22-28-15-7-2-8-16-28)35(41-24-30-19-11-4-12-20-30)34(32-26-38-32)40-23-29-17-9-3-10-18-29/h1-20,32-35H,21-26H2/t32-,33+,34-,35-/m0/s1 |
| InChIKey | HMZBMUFQHMGBFF-SNSGHMKVSA-N |
| XLogP | 5.93 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|