C46H45NO4 — CID 11767578
(2S,3R,4R)-4-[(2S)-oxiran-2-yl]-2,3,4-tris(phenylmethoxy)-N-tritylbutan-1-amine (PubChem CID 11767578) has the molecular formula C46H45NO4 and a molecular weight of 675.87 g/mol. Its IUPAC name is (2S,3R,4R)-4-[(2S)-oxiran-2-yl]-2,3,4-tris(phenylmethoxy)-N-tritylbutan-1-amine.
| Compound Name | (2S,3R,4R)-4-[(2S)-oxiran-2-yl]-2,3,4-tris(phenylmethoxy)-N-tritylbutan-1-amine |
|---|---|
| PubChem CID | 11767578 |
| Molecular Formula | C46H45NO4 |
| Molecular Weight | 675.87 g/mol |
| Exact Mass | 675.33 |
| IUPAC Name | (2S,3R,4R)-4-[(2S)-oxiran-2-yl]-2,3,4-tris(phenylmethoxy)-N-tritylbutan-1-amine |
| SMILES | c1ccc(CO[C@@H]([C@H](OCc2ccccc2)[C@@H]2CO2)[C@H](CNC(c2ccccc2)(c2ccccc2)c2ccccc2)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C46H45NO4/c1-7-19-36(20-8-1)32-48-42(31-47-46(39-25-13-4-14-26-39,40-27-15-5-16-28-40)41-29-17-6-18-30-41)44(50-33-37-21-9-2-10-22-37)45(43-35-49-43)51-34-38-23-11-3-12-24-38/h1-30,42-45,47H,31-35H2/t42-,43-,44+,45+/m0/s1 |
| InChIKey | PDRISAONKNDDLV-XIPUPUFSSA-N |
| XLogP | 8.72 |
| TPSA | 52.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.87 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|