C29H32O7 — CID 10505291
methyl (2S,3S)-3-[(1R,2S,3R)-4-hydroxy-1,2,3-tris(phenylmethoxy)butyl]oxirane-2-carboxylate (PubChem CID 10505291) has the molecular formula C29H32O7 and a molecular weight of 492.57 g/mol. Its IUPAC name is methyl (2S,3S)-3-[(1R,2S,3R)-4-hydroxy-1,2,3-tris(phenylmethoxy)butyl]oxirane-2-carboxylate.
| Compound Name | methyl (2S,3S)-3-[(1R,2S,3R)-4-hydroxy-1,2,3-tris(phenylmethoxy)butyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 10505291 |
| Molecular Formula | C29H32O7 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | methyl (2S,3S)-3-[(1R,2S,3R)-4-hydroxy-1,2,3-tris(phenylmethoxy)butyl]oxirane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@H]1[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](CO)OCc1ccccc1 |
| InChI | InChI=1S/C29H32O7/c1-32-29(31)28-27(36-28)26(35-20-23-15-9-4-10-16-23)25(34-19-22-13-7-3-8-14-22)24(17-30)33-18-21-11-5-2-6-12-21/h2-16,24-28,30H,17-20H2,1H3/t24-,25+,26-,27+,28+/m1/s1 |
| InChIKey | CWPCMLDTWSAARU-VFHRMQJUSA-N |
| XLogP | 3.68 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|