C47H47NO6 — CID 10865450
[(2R,3R,4R,5S)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(tritylamino)hexyl] formate (PubChem CID 10865450) has the molecular formula C47H47NO6 and a molecular weight of 721.89 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(tritylamino)hexyl] formate.
| Compound Name | [(2R,3R,4R,5S)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(tritylamino)hexyl] formate |
|---|---|
| PubChem CID | 10865450 |
| Molecular Formula | C47H47NO6 |
| Molecular Weight | 721.89 g/mol |
| Exact Mass | 721.34 |
| IUPAC Name | [(2R,3R,4R,5S)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(tritylamino)hexyl] formate |
| SMILES | O=COC[C@@H](O)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](CNC(c1ccccc1)(c1ccccc1)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C47H47NO6/c49-36-51-35-43(50)45(53-33-38-21-9-2-10-22-38)46(54-34-39-23-11-3-12-24-39)44(52-32-37-19-7-1-8-20-37)31-48-47(40-25-13-4-14-26-40,41-27-15-5-16-28-41)42-29-17-6-18-30-42/h1-30,36,43-46,48,50H,31-35H2/t43-,44+,45-,46-/m1/s1 |
| InChIKey | CLLAEKXBUHNJDA-GZOSUITBSA-N |
| XLogP | 7.86 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.89 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|