C36H40O7 — CID 10531373
(3S,4R,5R)-6,6-dimethoxy-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-one (PubChem CID 10531373) has the molecular formula C36H40O7 and a molecular weight of 584.71 g/mol. Its IUPAC name is (3S,4R,5R)-6,6-dimethoxy-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-one.
| Compound Name | (3S,4R,5R)-6,6-dimethoxy-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-one |
|---|---|
| PubChem CID | 10531373 |
| Molecular Formula | C36H40O7 |
| Molecular Weight | 584.71 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | (3S,4R,5R)-6,6-dimethoxy-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-one |
| SMILES | COC(OC)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)C(=O)COCc1ccccc1 |
| InChI | InChI=1S/C36H40O7/c1-38-36(39-2)35(43-26-31-21-13-6-14-22-31)34(42-25-30-19-11-5-12-20-30)33(41-24-29-17-9-4-10-18-29)32(37)27-40-23-28-15-7-3-8-16-28/h3-22,33-36H,23-27H2,1-2H3/t33-,34+,35-/m1/s1 |
| InChIKey | KXVFHGWVGDOHCO-GVBYMILNSA-N |
| XLogP | 6.15 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.71 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|