C36H43NO7 — CID 102364077
N-[(3R,4S,5R)-6,6-dimethoxy-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-yl]hydroxylamine (PubChem CID 102364077) has the molecular formula C36H43NO7 and a molecular weight of 601.74 g/mol. Its IUPAC name is N-[(3R,4S,5R)-6,6-dimethoxy-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-yl]hydroxylamine.
| Compound Name | N-[(3R,4S,5R)-6,6-dimethoxy-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 102364077 |
| Molecular Formula | C36H43NO7 |
| Molecular Weight | 601.74 g/mol |
| Exact Mass | 601.30 |
| IUPAC Name | N-[(3R,4S,5R)-6,6-dimethoxy-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-yl]hydroxylamine |
| SMILES | COC(OC)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)C(COCc1ccccc1)NO |
| InChI | InChI=1S/C36H43NO7/c1-39-36(40-2)35(44-26-31-21-13-6-14-22-31)34(43-25-30-19-11-5-12-20-30)33(42-24-29-17-9-4-10-18-29)32(37-38)27-41-23-28-15-7-3-8-16-28/h3-22,32-38H,23-27H2,1-2H3/t32?,33-,34+,35-/m1/s1 |
| InChIKey | ISANZYQBWJMUCS-SJPDHMOLSA-N |
| XLogP | 5.93 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.74 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|