C44H52N2O9 — CID 175366107
2-tert-butyl-2-[5-formyl-5-hydroxy-2,3,4,6-tetrakis(phenylmethoxy)hexanoyl]piperazine-1-carboxylic acid (PubChem CID 175366107) has the molecular formula C44H52N2O9 and a molecular weight of 752.91 g/mol. Its IUPAC name is 2-tert-butyl-2-[5-formyl-5-hydroxy-2,3,4,6-tetrakis(phenylmethoxy)hexanoyl]piperazine-1-carboxylic acid.
| Compound Name | 2-tert-butyl-2-[5-formyl-5-hydroxy-2,3,4,6-tetrakis(phenylmethoxy)hexanoyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 175366107 |
| Molecular Formula | C44H52N2O9 |
| Molecular Weight | 752.91 g/mol |
| Exact Mass | 752.37 |
| IUPAC Name | 2-tert-butyl-2-[5-formyl-5-hydroxy-2,3,4,6-tetrakis(phenylmethoxy)hexanoyl]piperazine-1-carboxylic acid |
| SMILES | CC(C)(C)C1(C(=O)C(OCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C(O)(C=O)COCc2ccccc2)CNCCN1C(=O)O |
| InChI | InChI=1S/C44H52N2O9/c1-42(2,3)44(30-45-24-25-46(44)41(49)50)39(48)37(53-27-34-18-10-5-11-19-34)38(54-28-35-20-12-6-13-21-35)40(55-29-36-22-14-7-15-23-36)43(51,31-47)32-52-26-33-16-8-4-9-17-33/h4-23,31,37-38,40,45,51H,24-30,32H2,1-3H3,(H,49,50) |
| InChIKey | NXJVEUPVMJZBFD-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.91 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|