C41H50N2O10S — CID 162716378
[(2R,3S,4S,5R,6R)-5,6-dihydroxy-1-oxo-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)-1-piperazin-1-ylheptan-2-yl] methanesulfonate (PubChem CID 162716378) has the molecular formula C41H50N2O10S and a molecular weight of 762.92 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-5,6-dihydroxy-1-oxo-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)-1-piperazin-1-ylheptan-2-yl] methanesulfonate.
| Compound Name | [(2R,3S,4S,5R,6R)-5,6-dihydroxy-1-oxo-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)-1-piperazin-1-ylheptan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 162716378 |
| Molecular Formula | C41H50N2O10S |
| Molecular Weight | 762.92 g/mol |
| Exact Mass | 762.32 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-5,6-dihydroxy-1-oxo-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)-1-piperazin-1-ylheptan-2-yl] methanesulfonate |
| SMILES | C[C@@H](O)[C@](O)(COCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@](OCc1ccccc1)(OS(C)(=O)=O)C(=O)N1CCNCC1 |
| InChI | InChI=1S/C41H50N2O10S/c1-32(44)40(46,31-49-27-33-15-7-3-8-16-33)37(50-28-34-17-9-4-10-18-34)38(51-29-35-19-11-5-12-20-35)41(53-54(2,47)48,39(45)43-25-23-42-24-26-43)52-30-36-21-13-6-14-22-36/h3-22,32,37-38,42,44,46H,23-31H2,1-2H3/t32-,37+,38+,40-,41-/m1/s1 |
| InChIKey | ZBAPNQXYYWKCRR-NCFPAXEYSA-N |
| XLogP | 3.81 |
| TPSA | 153.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.92 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|