C15H21N3O3 — CID 93481132
benzyl N-[(2S)-1-oxo-1-piperazin-1-ylpropan-2-yl]carbamate (PubChem CID 93481132) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is benzyl N-[(2S)-1-oxo-1-piperazin-1-ylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-oxo-1-piperazin-1-ylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 93481132 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | benzyl N-[(2S)-1-oxo-1-piperazin-1-ylpropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(=O)N1CCNCC1 |
| InChI | InChI=1S/C15H21N3O3/c1-12(14(19)18-9-7-16-8-10-18)17-15(20)21-11-13-5-3-2-4-6-13/h2-6,12,16H,7-11H2,1H3,(H,17,20)/t12-/m0/s1 |
| InChIKey | UPVXCRJPOABYLO-LBPRGKRZSA-N |
| XLogP | 0.73 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |