C24H29N3O4 — CID 89449308
benzyl N-[(2S)-1-oxo-1-[4-[4-(2-oxopropyl)phenyl]piperazin-1-yl]propan-2-yl]carbamate (PubChem CID 89449308) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is benzyl N-[(2S)-1-oxo-1-[4-[4-(2-oxopropyl)phenyl]piperazin-1-yl]propan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-oxo-1-[4-[4-(2-oxopropyl)phenyl]piperazin-1-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 89449308 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | benzyl N-[(2S)-1-oxo-1-[4-[4-(2-oxopropyl)phenyl]piperazin-1-yl]propan-2-yl]carbamate |
| SMILES | CC(=O)Cc1ccc(N2CCN(C(=O)[C@H](C)NC(=O)OCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H29N3O4/c1-18(28)16-20-8-10-22(11-9-20)26-12-14-27(15-13-26)23(29)19(2)25-24(30)31-17-21-6-4-3-5-7-21/h3-11,19H,12-17H2,1-2H3,(H,25,30)/t19-/m0/s1 |
| InChIKey | IXVCTTHGEOLANK-IBGZPJMESA-N |
| XLogP | 2.78 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|