C30H33N3O5 — CID 71266252
ethyl 2-[4-[4-[(2R)-2-phenyl-2-(phenylmethoxycarbonylamino)acetyl]piperazin-1-yl]phenyl]acetate (PubChem CID 71266252) has the molecular formula C30H33N3O5 and a molecular weight of 515.61 g/mol. Its IUPAC name is ethyl 2-[4-[4-[(2R)-2-phenyl-2-(phenylmethoxycarbonylamino)acetyl]piperazin-1-yl]phenyl]acetate.
| Compound Name | ethyl 2-[4-[4-[(2R)-2-phenyl-2-(phenylmethoxycarbonylamino)acetyl]piperazin-1-yl]phenyl]acetate |
|---|---|
| PubChem CID | 71266252 |
| Molecular Formula | C30H33N3O5 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | ethyl 2-[4-[4-[(2R)-2-phenyl-2-(phenylmethoxycarbonylamino)acetyl]piperazin-1-yl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(N2CCN(C(=O)[C@H](NC(=O)OCc3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C30H33N3O5/c1-2-37-27(34)21-23-13-15-26(16-14-23)32-17-19-33(20-18-32)29(35)28(25-11-7-4-8-12-25)31-30(36)38-22-24-9-5-3-6-10-24/h3-16,28H,2,17-22H2,1H3,(H,31,36)/t28-/m1/s1 |
| InChIKey | HBCILOIHOBUDNM-MUUNZHRXSA-N |
| XLogP | 4.11 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|