C28H31N3O5 — CID 144534143
2-[4-[4-[(3E)-3-ethenyl-2-(phenylmethoxycarbonylamino)hexa-3,5-dienoyl]piperazin-1-yl]phenyl]acetic acid (PubChem CID 144534143) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is 2-[4-[4-[(3E)-3-ethenyl-2-(phenylmethoxycarbonylamino)hexa-3,5-dienoyl]piperazin-1-yl]phenyl]acetic acid.
| Compound Name | 2-[4-[4-[(3E)-3-ethenyl-2-(phenylmethoxycarbonylamino)hexa-3,5-dienoyl]piperazin-1-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 144534143 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 2-[4-[4-[(3E)-3-ethenyl-2-(phenylmethoxycarbonylamino)hexa-3,5-dienoyl]piperazin-1-yl]phenyl]acetic acid |
| SMILES | C=C/C=C(\C=C)C(NC(=O)OCc1ccccc1)C(=O)N1CCN(c2ccc(CC(=O)O)cc2)CC1 |
| InChI | InChI=1S/C28H31N3O5/c1-3-8-23(4-2)26(29-28(35)36-20-22-9-6-5-7-10-22)27(34)31-17-15-30(16-18-31)24-13-11-21(12-14-24)19-25(32)33/h3-14,26H,1-2,15-20H2,(H,29,35)(H,32,33)/b23-8+ |
| InChIKey | WKIZRHGPZNJHHQ-LIMNOBDPSA-N |
| XLogP | 3.56 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|