C29H35N3O4 — CID 143172681
(2R,3S)-3-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]piperazine-1-carbonyl]-2-hydroxy-5-phenylmethoxypentanamide (PubChem CID 143172681) has the molecular formula C29H35N3O4 and a molecular weight of 489.62 g/mol. Its IUPAC name is (2R,3S)-3-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]piperazine-1-carbonyl]-2-hydroxy-5-phenylmethoxypentanamide.
| Compound Name | (2R,3S)-3-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]piperazine-1-carbonyl]-2-hydroxy-5-phenylmethoxypentanamide |
|---|---|
| PubChem CID | 143172681 |
| Molecular Formula | C29H35N3O4 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | (2R,3S)-3-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]piperazine-1-carbonyl]-2-hydroxy-5-phenylmethoxypentanamide |
| SMILES | C=C/C=C(\C=C)c1ccc(N2CCN(C(=O)[C@@H](CCOCc3ccccc3)[C@@H](O)C(N)=O)CC2)cc1 |
| InChI | InChI=1S/C29H35N3O4/c1-3-8-23(4-2)24-11-13-25(14-12-24)31-16-18-32(19-17-31)29(35)26(27(33)28(30)34)15-20-36-21-22-9-6-5-7-10-22/h3-14,26-27,33H,1-2,15-21H2,(H2,30,34)/b23-8+/t26-,27+/m0/s1 |
| InChIKey | PYTWUALTKBDJHZ-AOFKWLLGSA-N |
| XLogP | 3.16 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|