C29H33N3O5 — CID 87360266
(2R,3S)-N,2-dihydroxy-5-phenylmethoxy-3-[4-(4-phenylphenyl)piperazine-1-carbonyl]pentanamide (PubChem CID 87360266) has the molecular formula C29H33N3O5 and a molecular weight of 503.60 g/mol. Its IUPAC name is (2R,3S)-N,2-dihydroxy-5-phenylmethoxy-3-[4-(4-phenylphenyl)piperazine-1-carbonyl]pentanamide.
| Compound Name | (2R,3S)-N,2-dihydroxy-5-phenylmethoxy-3-[4-(4-phenylphenyl)piperazine-1-carbonyl]pentanamide |
|---|---|
| PubChem CID | 87360266 |
| Molecular Formula | C29H33N3O5 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | (2R,3S)-N,2-dihydroxy-5-phenylmethoxy-3-[4-(4-phenylphenyl)piperazine-1-carbonyl]pentanamide |
| SMILES | O=C(NO)[C@H](O)[C@H](CCOCc1ccccc1)C(=O)N1CCN(c2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C29H33N3O5/c33-27(28(34)30-36)26(15-20-37-21-22-7-3-1-4-8-22)29(35)32-18-16-31(17-19-32)25-13-11-24(12-14-25)23-9-5-2-6-10-23/h1-14,26-27,33,36H,15-21H2,(H,30,34)/t26-,27+/m0/s1 |
| InChIKey | QTZSEZPLRZEBOU-RRPNLBNLSA-N |
| XLogP | 3.09 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|